C17H17FN2O5 — CID 111912205
3-(4-fluoro-2-nitrophenyl)-N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]prop-2-enamide (PubChem CID 111912205) has the molecular formula C17H17FN2O5 and a molecular weight of 348.33 g/mol. Its IUPAC name is 3-(4-fluoro-2-nitrophenyl)-N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]prop-2-enamide.
| Compound Name | 3-(4-fluoro-2-nitrophenyl)-N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 111912205 |
| Molecular Formula | C17H17FN2O5 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3-(4-fluoro-2-nitrophenyl)-N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]prop-2-enamide |
| SMILES | Cc1ccc(C(C)(O)CNC(=O)C=Cc2ccc(F)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C17H17FN2O5/c1-11-3-7-15(25-11)17(2,22)10-19-16(21)8-5-12-4-6-13(18)9-14(12)20(23)24/h3-9,22H,10H2,1-2H3,(H,19,21) |
| InChIKey | SDLAZQISWJYKOM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|