C22H25N3O — CID 91942752
1-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one (PubChem CID 91942752) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91942752 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-n2ccnc2)cc1)N1CC2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H25N3O/c26-22(25-14-19-10-17-9-18(11-19)13-21(25)12-17)6-3-16-1-4-20(5-2-16)24-8-7-23-15-24/h1-8,15,17-19,21H,9-14H2 |
| InChIKey | PWCXWQRWRQAAPR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|