About N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide (PubChem CID 9194398) has the molecular formula C20H20FN3O2
and a molecular weight of 353.40 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide |
| PubChem CID | 9194398 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)COc1cccc(F)c1 |
| InChI | InChI=1S/C20H20FN3O2/c1-14-19(15(2)24(23-14)17-8-4-3-5-9-17)12-22-20(25)13-26-18-10-6-7-16(21)11-18/h3-11H,12-13H2,1-2H3,(H,22,25) |
| InChIKey | PXJHWUYRHAHKJM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide?
The IUPAC name of N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide (CID 9194398) is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide.
What is the SMILES notation for N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide?
The canonical SMILES for N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide is Cc1nn(-c2ccccc2)c(C)c1CNC(=O)COc1cccc(F)c1.
What is the InChIKey of N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide?
The InChIKey is PXJHWUYRHAHKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN3O2/c1-14-19(15(2)24(23-14)17-8-4-3-5-9-17)12-22-20(25)13-26-18-10-6-7-16(21)11-18/h3-11H,12-13H2,1-2H3,(H,22,25).
What are the key properties of N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide?
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide has a molecular weight of 353.40 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-(3-fluorophenoxy)acetamide is sourced from PubChem (CID 9194398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).