C19H18ClFN2O — CID 91944133
N-(4-chloro-2-fluorophenyl)-2-(2-phenylethenyl)pyrrolidine-1-carboxamide (PubChem CID 91944133) has the molecular formula C19H18ClFN2O and a molecular weight of 344.82 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(2-phenylethenyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(2-phenylethenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91944133 |
| Molecular Formula | C19H18ClFN2O |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(2-phenylethenyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)N1CCCC1C=Cc1ccccc1 |
| InChI | InChI=1S/C19H18ClFN2O/c20-15-9-11-18(17(21)13-15)22-19(24)23-12-4-7-16(23)10-8-14-5-2-1-3-6-14/h1-3,5-6,8-11,13,16H,4,7,12H2,(H,22,24) |
| InChIKey | TZPXAEFRYWVYKL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |