C15H22N4O4 — CID 91945727
ethyl 1-[2-[(1-methylpyrazole-3-carbonyl)amino]acetyl]piperidine-4-carboxylate (PubChem CID 91945727) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is ethyl 1-[2-[(1-methylpyrazole-3-carbonyl)amino]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(1-methylpyrazole-3-carbonyl)amino]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91945727 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 1-[2-[(1-methylpyrazole-3-carbonyl)amino]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CNC(=O)c2ccn(C)n2)CC1 |
| InChI | InChI=1S/C15H22N4O4/c1-3-23-15(22)11-4-8-19(9-5-11)13(20)10-16-14(21)12-6-7-18(2)17-12/h6-7,11H,3-5,8-10H2,1-2H3,(H,16,21) |
| InChIKey | UIZPLEVZALGQKY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |