C13H16ClN3O2S — CID 91956038
N-[3-(6-chloroindazol-1-yl)propyl]prop-2-ene-1-sulfonamide (PubChem CID 91956038) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is N-[3-(6-chloroindazol-1-yl)propyl]prop-2-ene-1-sulfonamide.
| Compound Name | N-[3-(6-chloroindazol-1-yl)propyl]prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 91956038 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[3-(6-chloroindazol-1-yl)propyl]prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)NCCCn1ncc2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H16ClN3O2S/c1-2-8-20(18,19)16-6-3-7-17-13-9-12(14)5-4-11(13)10-15-17/h2,4-5,9-10,16H,1,3,6-8H2 |
| InChIKey | RKYREOUGXNTZKK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|