C18H19ClN4O2 — CID 91959575
3-chloro-N-(3-indol-1-ylpropyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide (PubChem CID 91959575) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 3-chloro-N-(3-indol-1-ylpropyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide.
| Compound Name | 3-chloro-N-(3-indol-1-ylpropyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 91959575 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-chloro-N-(3-indol-1-ylpropyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide |
| SMILES | O=C(NCCCn1ccc2ccccc21)c1nn2c(c1Cl)OCCC2 |
| InChI | InChI=1S/C18H19ClN4O2/c19-15-16(21-23-10-4-12-25-18(15)23)17(24)20-8-3-9-22-11-7-13-5-1-2-6-14(13)22/h1-2,5-7,11H,3-4,8-10,12H2,(H,20,24) |
| InChIKey | CHNZKSSWLQGNAA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|