C20H23N5O — CID 91960851
6-methyl-N-(3-prop-2-enoxyphenyl)-2-pyrrolidin-1-yl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 91960851) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 6-methyl-N-(3-prop-2-enoxyphenyl)-2-pyrrolidin-1-yl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-(3-prop-2-enoxyphenyl)-2-pyrrolidin-1-yl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91960851 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 6-methyl-N-(3-prop-2-enoxyphenyl)-2-pyrrolidin-1-yl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=CCOc1cccc(Nc2nc(N3CCCC3)nc3[nH]c(C)cc23)c1 |
| InChI | InChI=1S/C20H23N5O/c1-3-11-26-16-8-6-7-15(13-16)22-19-17-12-14(2)21-18(17)23-20(24-19)25-9-4-5-10-25/h3,6-8,12-13H,1,4-5,9-11H2,2H3,(H2,21,22,23,24) |
| InChIKey | IZAPMTCPMPMARS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|