C24H24N4O2 — CID 91963252
1-[3-[[4-[(2-methoxyphenyl)methylamino]quinazolin-2-yl]amino]phenyl]ethanol (PubChem CID 91963252) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-[3-[[4-[(2-methoxyphenyl)methylamino]quinazolin-2-yl]amino]phenyl]ethanol.
| Compound Name | 1-[3-[[4-[(2-methoxyphenyl)methylamino]quinazolin-2-yl]amino]phenyl]ethanol |
|---|---|
| PubChem CID | 91963252 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[3-[[4-[(2-methoxyphenyl)methylamino]quinazolin-2-yl]amino]phenyl]ethanol |
| SMILES | COc1ccccc1CNc1nc(Nc2cccc(C(C)O)c2)nc2ccccc12 |
| InChI | InChI=1S/C24H24N4O2/c1-16(29)17-9-7-10-19(14-17)26-24-27-21-12-5-4-11-20(21)23(28-24)25-15-18-8-3-6-13-22(18)30-2/h3-14,16,29H,15H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | HJBNAFSVSFGCTA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |