C15H18ClN5O2 — CID 91967706
1-(5-chloro-2-methoxyphenyl)-3-[[2-(dimethylamino)pyrimidin-4-yl]methyl]urea (PubChem CID 91967706) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[[2-(dimethylamino)pyrimidin-4-yl]methyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[[2-(dimethylamino)pyrimidin-4-yl]methyl]urea |
|---|---|
| PubChem CID | 91967706 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[[2-(dimethylamino)pyrimidin-4-yl]methyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCc1ccnc(N(C)C)n1 |
| InChI | InChI=1S/C15H18ClN5O2/c1-21(2)14-17-7-6-11(19-14)9-18-15(22)20-12-8-10(16)4-5-13(12)23-3/h4-8H,9H2,1-3H3,(H2,18,20,22) |
| InChIKey | IPVSOBRTXPEPHB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |