C9H14N4O — CID 91967806
N-[2-(dimethylamino)pyrimidin-5-yl]propanamide (PubChem CID 91967806) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N-[2-(dimethylamino)pyrimidin-5-yl]propanamide.
| Compound Name | N-[2-(dimethylamino)pyrimidin-5-yl]propanamide |
|---|---|
| PubChem CID | 91967806 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-[2-(dimethylamino)pyrimidin-5-yl]propanamide |
| SMILES | CCC(=O)Nc1cnc(N(C)C)nc1 |
| InChI | InChI=1S/C9H14N4O/c1-4-8(14)12-7-5-10-9(11-6-7)13(2)3/h5-6H,4H2,1-3H3,(H,12,14) |
| InChIKey | RSHOFJIMPHPSCC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |