C30H39FN6O2 — CID 91970759
N-[(3R,5S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 91970759) has the molecular formula C30H39FN6O2 and a molecular weight of 534.68 g/mol. Its IUPAC name is N-[(3R,5S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(3R,5S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91970759 |
| Molecular Formula | C30H39FN6O2 |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | N-[(3R,5S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(F)c1CN1C[C@@H](C)C[C@@H](NC(=O)C2CCC3NNC(c4ccc5nn(C)cc5c4)C3C2)C1 |
| InChI | InChI=1S/C30H39FN6O2/c1-18-11-22(16-37(14-18)17-24-25(31)5-4-6-28(24)39-3)32-30(38)20-8-10-27-23(13-20)29(34-33-27)19-7-9-26-21(12-19)15-36(2)35-26/h4-7,9,12,15,18,20,22-23,27,29,33-34H,8,10-11,13-14,16-17H2,1-3H3,(H,32,38)/t18-,20?,22+,23?,27?,29?/m0/s1 |
| InChIKey | ARLLCCZXQHFVDJ-FIKRLFMBSA-N |
| XLogP | 3.68 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |