C28H38FN5O2 — CID 91970756
N-[(3R,5R)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 91970756) has the molecular formula C28H38FN5O2 and a molecular weight of 495.64 g/mol. Its IUPAC name is N-[(3R,5R)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(3R,5R)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91970756 |
| Molecular Formula | C28H38FN5O2 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | N-[(3R,5R)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(F)c1CN1C[C@H](C)C[C@@H](NC(=O)C2CCC3NNC(c4ccnc(C)c4)C3C2)C1 |
| InChI | InChI=1S/C28H38FN5O2/c1-17-11-21(15-34(14-17)16-23-24(29)5-4-6-26(23)36-3)31-28(35)20-7-8-25-22(13-20)27(33-32-25)19-9-10-30-18(2)12-19/h4-6,9-10,12,17,20-22,25,27,32-33H,7-8,11,13-16H2,1-3H3,(H,31,35)/t17-,20?,21-,22?,25?,27?/m1/s1 |
| InChIKey | KVVRCUROEQEXIX-QPPVFLAGSA-N |
| XLogP | 3.50 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |