C26H34ClN5O — CID 91970741
N-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 91970741) has the molecular formula C26H34ClN5O and a molecular weight of 468.05 g/mol. Its IUPAC name is N-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91970741 |
| Molecular Formula | C26H34ClN5O |
| Molecular Weight | 468.05 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-[(3R)-1-[(2-chlorophenyl)methyl]piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1cc(C2NNC3CCC(C(=O)N[C@@H]4CCCN(Cc5ccccc5Cl)C4)CC32)ccn1 |
| InChI | InChI=1S/C26H34ClN5O/c1-17-13-18(10-11-28-17)25-22-14-19(8-9-24(22)30-31-25)26(33)29-21-6-4-12-32(16-21)15-20-5-2-3-7-23(20)27/h2-3,5,7,10-11,13,19,21-22,24-25,30-31H,4,6,8-9,12,14-16H2,1H3,(H,29,33)/t19?,21-,22?,24?,25?/m1/s1 |
| InChIKey | QXUBOOPTHCOYJV-ZYIPEJEJSA-N |
| XLogP | 3.76 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.05 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |