C28H35N5OS — CID 91970740
N-[(3R)-1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 91970740) has the molecular formula C28H35N5OS and a molecular weight of 489.69 g/mol. Its IUPAC name is N-[(3R)-1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(3R)-1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91970740 |
| Molecular Formula | C28H35N5OS |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-[(3R)-1-(1-benzothiophen-3-ylmethyl)piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1cc(C2NNC3CCC(C(=O)N[C@@H]4CCCN(Cc5csc6ccccc56)C4)CC32)ccn1 |
| InChI | InChI=1S/C28H35N5OS/c1-18-13-19(10-11-29-18)27-24-14-20(8-9-25(24)31-32-27)28(34)30-22-5-4-12-33(16-22)15-21-17-35-26-7-3-2-6-23(21)26/h2-3,6-7,10-11,13,17,20,22,24-25,27,31-32H,4-5,8-9,12,14-16H2,1H3,(H,30,34)/t20?,22-,24?,25?,27?/m1/s1 |
| InChIKey | ZOPKRCPESROUIS-SBANCMRCSA-N |
| XLogP | 4.32 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |