C30H36N6O2 — CID 129010710
N-[(1S,3S)-3-[(3-cyanoindol-1-yl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 129010710) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is N-[(1S,3S)-3-[(3-cyanoindol-1-yl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(1S,3S)-3-[(3-cyanoindol-1-yl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 129010710 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | N-[(1S,3S)-3-[(3-cyanoindol-1-yl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1cc(C2NNC3CCC(C(=O)N[C@H]4CCC[C@@](O)(Cn5cc(C#N)c6ccccc65)C4)CC32)ccn1 |
| InChI | InChI=1S/C30H36N6O2/c1-19-13-20(10-12-32-19)28-25-14-21(8-9-26(25)34-35-28)29(37)33-23-5-4-11-30(38,15-23)18-36-17-22(16-31)24-6-2-3-7-27(24)36/h2-3,6-7,10,12-13,17,21,23,25-26,28,34-35,38H,4-5,8-9,11,14-15,18H2,1H3,(H,33,37)/t21?,23-,25?,26?,28?,30-/m0/s1 |
| InChIKey | CUCNMRJDTBMVGK-NAFOFUHZSA-N |
| XLogP | 3.64 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |