C29H39FN4O3 — CID 129010661
N-[(1R,3S)-3-[(2-fluorophenyl)methyl]-3-hydroxycyclohexyl]-3-(2-propan-2-yloxy-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 129010661) has the molecular formula C29H39FN4O3 and a molecular weight of 510.65 g/mol. Its IUPAC name is N-[(1R,3S)-3-[(2-fluorophenyl)methyl]-3-hydroxycyclohexyl]-3-(2-propan-2-yloxy-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(1R,3S)-3-[(2-fluorophenyl)methyl]-3-hydroxycyclohexyl]-3-(2-propan-2-yloxy-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 129010661 |
| Molecular Formula | C29H39FN4O3 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-[(1R,3S)-3-[(2-fluorophenyl)methyl]-3-hydroxycyclohexyl]-3-(2-propan-2-yloxy-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | CC(C)Oc1cc(C2NNC3CCC(C(=O)N[C@@H]4CCC[C@](O)(Cc5ccccc5F)C4)CC32)ccn1 |
| InChI | InChI=1S/C29H39FN4O3/c1-18(2)37-26-15-19(11-13-31-26)27-23-14-20(9-10-25(23)33-34-27)28(35)32-22-7-5-12-29(36,17-22)16-21-6-3-4-8-24(21)30/h3-4,6,8,11,13,15,18,20,22-23,25,27,33-34,36H,5,7,9-10,12,14,16-17H2,1-2H3,(H,32,35)/t20?,22-,23?,25?,27?,29+/m1/s1 |
| InChIKey | RALNESJNRCPKBG-NXRXXVLMSA-N |
| XLogP | 3.97 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |