C30H37N5O3 — CID 129010708
N-[(1R,3S)-3-hydroxy-3-[(2-oxoquinolin-1-yl)methyl]cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 129010708) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is N-[(1R,3S)-3-hydroxy-3-[(2-oxoquinolin-1-yl)methyl]cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(1R,3S)-3-hydroxy-3-[(2-oxoquinolin-1-yl)methyl]cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 129010708 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | N-[(1R,3S)-3-hydroxy-3-[(2-oxoquinolin-1-yl)methyl]cyclohexyl]-3-(2-methyl-4-pyridinyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1cc(C2NNC3CCC(C(=O)N[C@@H]4CCC[C@@](O)(Cn5c(=O)ccc6ccccc65)C4)CC32)ccn1 |
| InChI | InChI=1S/C30H37N5O3/c1-19-15-21(12-14-31-19)28-24-16-22(8-10-25(24)33-34-28)29(37)32-23-6-4-13-30(38,17-23)18-35-26-7-3-2-5-20(26)9-11-27(35)36/h2-3,5,7,9,11-12,14-15,22-25,28,33-34,38H,4,6,8,10,13,16-18H2,1H3,(H,32,37)/t22?,23-,24?,25?,28?,30+/m1/s1 |
| InChIKey | WSYIPJKOZCWUPN-KFQCAORGSA-N |
| XLogP | 3.13 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |