C29H34F2N6O — CID 91970775
N-[(1R,4R)-2-[(2,6-difluorophenyl)methyl]-2-azabicyclo[2.2.1]heptan-6-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 91970775) has the molecular formula C29H34F2N6O and a molecular weight of 520.63 g/mol. Its IUPAC name is N-[(1R,4R)-2-[(2,6-difluorophenyl)methyl]-2-azabicyclo[2.2.1]heptan-6-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(1R,4R)-2-[(2,6-difluorophenyl)methyl]-2-azabicyclo[2.2.1]heptan-6-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91970775 |
| Molecular Formula | C29H34F2N6O |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | N-[(1R,4R)-2-[(2,6-difluorophenyl)methyl]-2-azabicyclo[2.2.1]heptan-6-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cn1cc2cc(C3NNC4CCC(C(=O)NC5C[C@@H]6C[C@H]5N(Cc5c(F)cccc5F)C6)CC43)ccc2n1 |
| InChI | InChI=1S/C29H34F2N6O/c1-36-14-19-11-17(5-7-24(19)35-36)28-20-12-18(6-8-25(20)33-34-28)29(38)32-26-9-16-10-27(26)37(13-16)15-21-22(30)3-2-4-23(21)31/h2-5,7,11,14,16,18,20,25-28,33-34H,6,8-10,12-13,15H2,1H3,(H,32,38)/t16-,18?,20?,25?,26?,27-,28?/m1/s1 |
| InChIKey | FBRSTWIRPXHDGV-XGYCFLRXSA-N |
| XLogP | 3.56 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |