C24H34FN7O — CID 156600435
6-fluoro-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-5-(1-methylpyrazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 156600435) has the molecular formula C24H34FN7O and a molecular weight of 455.58 g/mol. Its IUPAC name is 6-fluoro-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-5-(1-methylpyrazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | 6-fluoro-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-5-(1-methylpyrazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 156600435 |
| Molecular Formula | C24H34FN7O |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 6-fluoro-N-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-5-(1-methylpyrazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)C3NNC4CC(F)C(c5cnn(C)c5)CC43)cc2)CC1 |
| InChI | InChI=1S/C24H34FN7O/c1-30-7-9-32(10-8-30)14-16-3-5-18(6-4-16)27-24(33)23-20-11-19(17-13-26-31(2)15-17)21(25)12-22(20)28-29-23/h3-6,13,15,19-23,28-29H,7-12,14H2,1-2H3,(H,27,33) |
| InChIKey | KRHIWOZPOIBZGO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |