C23H29ClN2O2 — CID 91972462
N-[(E)-1-[4-[(4-chlorophenyl)methoxy]phenyl]ethylideneamino]octanamide (PubChem CID 91972462) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is N-[(E)-1-[4-[(4-chlorophenyl)methoxy]phenyl]ethylideneamino]octanamide.
| Compound Name | N-[(E)-1-[4-[(4-chlorophenyl)methoxy]phenyl]ethylideneamino]octanamide |
|---|---|
| PubChem CID | 91972462 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[(E)-1-[4-[(4-chlorophenyl)methoxy]phenyl]ethylideneamino]octanamide |
| SMILES | CCCCCCCC(=O)N/N=C(\C)c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H29ClN2O2/c1-3-4-5-6-7-8-23(27)26-25-18(2)20-11-15-22(16-12-20)28-17-19-9-13-21(24)14-10-19/h9-16H,3-8,17H2,1-2H3,(H,26,27)/b25-18+ |
| InChIKey | KTDAOYOKTQXCAT-XIEYBQDHSA-N |
| XLogP | 6.12 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|