C18H12N2O5S — CID 91973237
3-(furan-2-carbonyl)-4-hydroxy-2-(2-hydroxyphenyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one (PubChem CID 91973237) has the molecular formula C18H12N2O5S and a molecular weight of 368.37 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-4-hydroxy-2-(2-hydroxyphenyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(2-hydroxyphenyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 91973237 |
| Molecular Formula | C18H12N2O5S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(2-hydroxyphenyl)-1-(1,3-thiazol-2-yl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2nccs2)C1c1ccccc1O)c1ccco1 |
| InChI | InChI=1S/C18H12N2O5S/c21-11-5-2-1-4-10(11)14-13(15(22)12-6-3-8-25-12)16(23)17(24)20(14)18-19-7-9-26-18/h1-9,14,21,23H |
| InChIKey | QAKTVXQWIRYDJP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|