C22H23NO7 — CID 9197667
[2-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(ethyl)amino]-2-oxoethyl] 2-(2-formylphenoxy)acetate (PubChem CID 9197667) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(ethyl)amino]-2-oxoethyl] 2-(2-formylphenoxy)acetate.
| Compound Name | [2-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(ethyl)amino]-2-oxoethyl] 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 9197667 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [2-[2,3-dihydro-1,4-benzodioxin-6-ylmethyl(ethyl)amino]-2-oxoethyl] 2-(2-formylphenoxy)acetate |
| SMILES | CCN(Cc1ccc2c(c1)OCCO2)C(=O)COC(=O)COc1ccccc1C=O |
| InChI | InChI=1S/C22H23NO7/c1-2-23(12-16-7-8-19-20(11-16)28-10-9-27-19)21(25)14-30-22(26)15-29-18-6-4-3-5-17(18)13-24/h3-8,11,13H,2,9-10,12,14-15H2,1H3 |
| InChIKey | GXEYKJUYWJLEKF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|