C23H21NO5 — CID 9009854
N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2-(1-formylnaphthalen-2-yl)oxyacetamide (PubChem CID 9009854) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2-(1-formylnaphthalen-2-yl)oxyacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2-(1-formylnaphthalen-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 9009854 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2-(1-formylnaphthalen-2-yl)oxyacetamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)COc1ccc2ccccc2c1C=O |
| InChI | InChI=1S/C23H21NO5/c1-2-24(12-16-7-9-21-22(11-16)29-15-28-21)23(26)14-27-20-10-8-17-5-3-4-6-18(17)19(20)13-25/h3-11,13H,2,12,14-15H2,1H3 |
| InChIKey | GFJQRODOTWIMMH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|