C25H19NO3 — CID 28913283
2-(1-formylnaphthalen-2-yl)oxy-N,N-diphenylacetamide (PubChem CID 28913283) has the molecular formula C25H19NO3 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-(1-formylnaphthalen-2-yl)oxy-N,N-diphenylacetamide.
| Compound Name | 2-(1-formylnaphthalen-2-yl)oxy-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 28913283 |
| Molecular Formula | C25H19NO3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-(1-formylnaphthalen-2-yl)oxy-N,N-diphenylacetamide |
| SMILES | O=Cc1c(OCC(=O)N(c2ccccc2)c2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C25H19NO3/c27-17-23-22-14-8-7-9-19(22)15-16-24(23)29-18-25(28)26(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-17H,18H2 |
| InChIKey | SRMIJWIVNXKWKH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|