C12H22OSi — CID 91982734
(7S)-2,2,5-trimethyl-7-(2-methylprop-2-enyl)-6,7-dihydro-3H-oxasilepine (PubChem CID 91982734) has the molecular formula C12H22OSi and a molecular weight of 210.39 g/mol. Its IUPAC name is (7S)-2,2,5-trimethyl-7-(2-methylprop-2-enyl)-6,7-dihydro-3H-oxasilepine.
| Compound Name | (7S)-2,2,5-trimethyl-7-(2-methylprop-2-enyl)-6,7-dihydro-3H-oxasilepine |
|---|---|
| PubChem CID | 91982734 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (7S)-2,2,5-trimethyl-7-(2-methylprop-2-enyl)-6,7-dihydro-3H-oxasilepine |
| SMILES | C=C(C)C[C@H]1CC(C)=CC[Si](C)(C)O1 |
| InChI | InChI=1S/C12H22OSi/c1-10(2)8-12-9-11(3)6-7-14(4,5)13-12/h6,12H,1,7-9H2,2-5H3/t12-/m0/s1 |
| InChIKey | HJQZFXYFOCWMSS-LBPRGKRZSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|