C13H23F3OSi — CID 158174309
tert-butyl-dimethyl-[4-(trifluoromethyl)cyclohex-3-en-1-yl]oxysilane (PubChem CID 158174309) has the molecular formula C13H23F3OSi and a molecular weight of 280.41 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-(trifluoromethyl)cyclohex-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[4-(trifluoromethyl)cyclohex-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 158174309 |
| Molecular Formula | C13H23F3OSi |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl-dimethyl-[4-(trifluoromethyl)cyclohex-3-en-1-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3OSi/c1-12(2,3)18(4,5)17-11-8-6-10(7-9-11)13(14,15)16/h6,11H,7-9H2,1-5H3 |
| InChIKey | OXQIFESRLLAXHK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|