C13H25IOSi — CID 141407624
triethyl-[4-(iodomethyl)cyclohex-3-en-1-yl]oxysilane (PubChem CID 141407624) has the molecular formula C13H25IOSi and a molecular weight of 352.33 g/mol. Its IUPAC name is triethyl-[4-(iodomethyl)cyclohex-3-en-1-yl]oxysilane.
| Compound Name | triethyl-[4-(iodomethyl)cyclohex-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 141407624 |
| Molecular Formula | C13H25IOSi |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | triethyl-[4-(iodomethyl)cyclohex-3-en-1-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC1CC=C(CI)CC1 |
| InChI | InChI=1S/C13H25IOSi/c1-4-16(5-2,6-3)15-13-9-7-12(11-14)8-10-13/h7,13H,4-6,8-11H2,1-3H3 |
| InChIKey | SCEPUHQZRZQGOY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|