C10H16LiN2O2 — CID 91986678
CID 91986678 (PubChem CID 91986678) has the molecular formula C10H16LiN2O2 and a molecular weight of 203.19 g/mol.
| Compound Name | CID 91986678 |
|---|---|
| PubChem CID | 91986678 |
| Molecular Formula | C10H16LiN2O2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | — |
| SMILES | CN1CCN(CCC#CC(=O)O)CC1.[Li] |
| InChI | InChI=1S/C10H16N2O2.Li/c1-11-6-8-12(9-7-11)5-3-2-4-10(13)14;/h3,5-9H2,1H3,(H,13,14); |
| InChIKey | HAUJPHLOKOWTCK-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|