C8H10O8 — CID 91989858
dimethyl (3S,4S)-3,4-dihydroxy-2-oxooxolane-3,4-dicarboxylate (PubChem CID 91989858) has the molecular formula C8H10O8 and a molecular weight of 234.16 g/mol. Its IUPAC name is dimethyl (3S,4S)-3,4-dihydroxy-2-oxooxolane-3,4-dicarboxylate.
| Compound Name | dimethyl (3S,4S)-3,4-dihydroxy-2-oxooxolane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 91989858 |
| Molecular Formula | C8H10O8 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | dimethyl (3S,4S)-3,4-dihydroxy-2-oxooxolane-3,4-dicarboxylate |
| SMILES | COC(=O)[C@]1(O)C(=O)OC[C@@]1(O)C(=O)OC |
| InChI | InChI=1S/C8H10O8/c1-14-4(9)7(12)3-16-6(11)8(7,13)5(10)15-2/h12-13H,3H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | SWDMZXHWAPOUHP-SFYZADRCSA-N |
| XLogP | -2.65 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|