C22H20ClNO5 — CID 9199644
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-(2-formyl-4-methoxyphenoxy)-N-methylacetamide (PubChem CID 9199644) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-(2-formyl-4-methoxyphenoxy)-N-methylacetamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-(2-formyl-4-methoxyphenoxy)-N-methylacetamide |
|---|---|
| PubChem CID | 9199644 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-(2-formyl-4-methoxyphenoxy)-N-methylacetamide |
| SMILES | COc1ccc(OCC(=O)N(C)Cc2ccc(-c3ccc(Cl)cc3)o2)c(C=O)c1 |
| InChI | InChI=1S/C22H20ClNO5/c1-24(12-19-8-10-21(29-19)15-3-5-17(23)6-4-15)22(26)14-28-20-9-7-18(27-2)11-16(20)13-25/h3-11,13H,12,14H2,1-2H3 |
| InChIKey | FOKRIRBQGWQOPI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|