C17H25NO4 — CID 920192
methyl (1R,5E)-2,2-dimethyl-4,6-dioxo-5-(1-pyrrolidin-1-ylpropylidene)cyclohexane-1-carboxylate (PubChem CID 920192) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl (1R,5E)-2,2-dimethyl-4,6-dioxo-5-(1-pyrrolidin-1-ylpropylidene)cyclohexane-1-carboxylate.
| Compound Name | methyl (1R,5E)-2,2-dimethyl-4,6-dioxo-5-(1-pyrrolidin-1-ylpropylidene)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 920192 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | methyl (1R,5E)-2,2-dimethyl-4,6-dioxo-5-(1-pyrrolidin-1-ylpropylidene)cyclohexane-1-carboxylate |
| SMILES | CC/C(=C1/C(=O)CC(C)(C)[C@@H](C(=O)OC)C1=O)N1CCCC1 |
| InChI | InChI=1S/C17H25NO4/c1-5-11(18-8-6-7-9-18)13-12(19)10-17(2,3)14(15(13)20)16(21)22-4/h14H,5-10H2,1-4H3/b13-11+/t14-/m1/s1 |
| InChIKey | DIXAWOKKVCXKMB-YPDDLIOESA-N |
| XLogP | 2.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|