C16H12N4O2 — CID 920400
2-(1,3-benzoxazol-2-ylamino)-1-methylquinazolin-4-one (PubChem CID 920400) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-1-methylquinazolin-4-one.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-1-methylquinazolin-4-one |
|---|---|
| PubChem CID | 920400 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-1-methylquinazolin-4-one |
| SMILES | Cn1c(Nc2nc3ccccc3o2)nc(=O)c2ccccc21 |
| InChI | InChI=1S/C16H12N4O2/c1-20-12-8-4-2-6-10(12)14(21)18-15(20)19-16-17-11-7-3-5-9-13(11)22-16/h2-9H,1H3,(H,17,18,19,21) |
| InChIKey | XXEUEZGNRLUQBG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |