C14H20FN3O3S — CID 9205248
3-(4-fluorophenyl)sulfonyl-N-(4-methylpiperazin-1-yl)propanamide (PubChem CID 9205248) has the molecular formula C14H20FN3O3S and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-N-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-N-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 9205248 |
| Molecular Formula | C14H20FN3O3S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-N-(4-methylpiperazin-1-yl)propanamide |
| SMILES | CN1CCN(NC(=O)CCS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H20FN3O3S/c1-17-7-9-18(10-8-17)16-14(19)6-11-22(20,21)13-4-2-12(15)3-5-13/h2-5H,6-11H2,1H3,(H,16,19) |
| InChIKey | TZXSMYNZHBFHCF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |