C18H22BrN2O4+ — CID 9205251
[4-[(2S)-3-(4-bromophenoxy)-2-hydroxypropyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone (PubChem CID 9205251) has the molecular formula C18H22BrN2O4+ and a molecular weight of 410.29 g/mol. Its IUPAC name is [4-[(2S)-3-(4-bromophenoxy)-2-hydroxypropyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[(2S)-3-(4-bromophenoxy)-2-hydroxypropyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 9205251 |
| Molecular Formula | C18H22BrN2O4+ |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [4-[(2S)-3-(4-bromophenoxy)-2-hydroxypropyl]piperazin-4-ium-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CC[NH+](C[C@H](O)COc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H21BrN2O4/c19-14-3-5-16(6-4-14)25-13-15(22)12-20-7-9-21(10-8-20)18(23)17-2-1-11-24-17/h1-6,11,15,22H,7-10,12-13H2/p+1/t15-/m0/s1 |
| InChIKey | UXRJPJQVDRXLGK-HNNXBMFYSA-O |
| XLogP | 0.82 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |