C15H19ClN2O2S — CID 920702
N-(azepane-1-carbothioyl)-2-(2-chlorophenoxy)acetamide (PubChem CID 920702) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is N-(azepane-1-carbothioyl)-2-(2-chlorophenoxy)acetamide.
| Compound Name | N-(azepane-1-carbothioyl)-2-(2-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 920702 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(azepane-1-carbothioyl)-2-(2-chlorophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1Cl)NC(=S)N1CCCCCC1 |
| InChI | InChI=1S/C15H19ClN2O2S/c16-12-7-3-4-8-13(12)20-11-14(19)17-15(21)18-9-5-1-2-6-10-18/h3-4,7-8H,1-2,5-6,9-11H2,(H,17,19,21) |
| InChIKey | XIILCCAJHISTCQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|