C15H15F2NOS — CID 9209398
N-(2,4-difluorophenyl)-5-methyl-4-propylthiophene-2-carboxamide (PubChem CID 9209398) has the molecular formula C15H15F2NOS and a molecular weight of 295.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-methyl-4-propylthiophene-2-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-methyl-4-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 9209398 |
| Molecular Formula | C15H15F2NOS |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-methyl-4-propylthiophene-2-carboxamide |
| SMILES | CCCc1cc(C(=O)Nc2ccc(F)cc2F)sc1C |
| InChI | InChI=1S/C15H15F2NOS/c1-3-4-10-7-14(20-9(10)2)15(19)18-13-6-5-11(16)8-12(13)17/h5-8H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | CKWMTEHXBOXODD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |