C16H16N2OS — CID 9213194
2,5,6-trimethyl-4-(3-methylphenoxy)thieno[2,3-d]pyrimidine (PubChem CID 9213194) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 2,5,6-trimethyl-4-(3-methylphenoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 2,5,6-trimethyl-4-(3-methylphenoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 9213194 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2,5,6-trimethyl-4-(3-methylphenoxy)thieno[2,3-d]pyrimidine |
| SMILES | Cc1cccc(Oc2nc(C)nc3sc(C)c(C)c23)c1 |
| InChI | InChI=1S/C16H16N2OS/c1-9-6-5-7-13(8-9)19-15-14-10(2)11(3)20-16(14)18-12(4)17-15/h5-8H,1-4H3 |
| InChIKey | ZBFKRTZUTJTGRI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |