C18H18N2O3S — CID 9251221
ethyl 2-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzoate (PubChem CID 9251221) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is ethyl 2-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzoate.
| Compound Name | ethyl 2-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzoate |
|---|---|
| PubChem CID | 9251221 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | ethyl 2-(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)oxybenzoate |
| SMILES | CCOC(=O)c1ccccc1Oc1nc(C)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C18H18N2O3S/c1-5-22-18(21)13-8-6-7-9-14(13)23-16-15-10(2)11(3)24-17(15)20-12(4)19-16/h6-9H,5H2,1-4H3 |
| InChIKey | AQTBNFYMMSDWET-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |