C24H25N3O3 — CID 9213620
(3R)-3-(carbamoylamino)-N-(4-ethylphenyl)-3-(3-phenoxyphenyl)propanamide (PubChem CID 9213620) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-N-(4-ethylphenyl)-3-(3-phenoxyphenyl)propanamide.
| Compound Name | (3R)-3-(carbamoylamino)-N-(4-ethylphenyl)-3-(3-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 9213620 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (3R)-3-(carbamoylamino)-N-(4-ethylphenyl)-3-(3-phenoxyphenyl)propanamide |
| SMILES | CCc1ccc(NC(=O)C[C@@H](NC(N)=O)c2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-2-17-11-13-19(14-12-17)26-23(28)16-22(27-24(25)29)18-7-6-10-21(15-18)30-20-8-4-3-5-9-20/h3-15,22H,2,16H2,1H3,(H,26,28)(H3,25,27,29)/t22-/m1/s1 |
| InChIKey | PXPHSAZRDWQADV-JOCHJYFZSA-N |
| XLogP | 4.78 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |