C22H30N4O3 — CID 119640789
N-(2-amino-2-ethylbutyl)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanamide (PubChem CID 119640789) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 119640789 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanamide |
| SMILES | CCC(N)(CC)CNC(=O)CC(NC(N)=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H30N4O3/c1-3-22(24,4-2)15-25-20(27)14-19(26-21(23)28)16-9-8-12-18(13-16)29-17-10-6-5-7-11-17/h5-13,19H,3-4,14-15,24H2,1-2H3,(H,25,27)(H3,23,26,28) |
| InChIKey | XXTBLCDWRBQHBW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |