C23H24N4O5S — CID 4850353
3-(carbamoylamino)-3-(3-phenoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]propanamide (PubChem CID 4850353) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is 3-(carbamoylamino)-3-(3-phenoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]propanamide.
| Compound Name | 3-(carbamoylamino)-3-(3-phenoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 4850353 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 3-(carbamoylamino)-3-(3-phenoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]propanamide |
| SMILES | NC(=O)NC(CC(=O)NCc1ccc(S(N)(=O)=O)cc1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N4O5S/c24-23(29)27-21(17-5-4-8-19(13-17)32-18-6-2-1-3-7-18)14-22(28)26-15-16-9-11-20(12-10-16)33(25,30)31/h1-13,21H,14-15H2,(H,26,28)(H3,24,27,29)(H2,25,30,31) |
| InChIKey | KSPXKSNDKKNCQB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |