C18H19N3O5 — CID 8008898
(2-amino-2-oxoethyl) (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate (PubChem CID 8008898) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate.
| Compound Name | (2-amino-2-oxoethyl) (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate |
|---|---|
| PubChem CID | 8008898 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (2-amino-2-oxoethyl) (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate |
| SMILES | NC(=O)COC(=O)C[C@@H](NC(N)=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C18H19N3O5/c19-16(22)11-25-17(23)10-15(21-18(20)24)12-5-4-8-14(9-12)26-13-6-2-1-3-7-13/h1-9,15H,10-11H2,(H2,19,22)(H3,20,21,24)/t15-/m1/s1 |
| InChIKey | XZKVCWSQOJJJFB-OAHLLOKOSA-N |
| XLogP | 1.61 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |