C24H21ClN2O5 — CID 2401781
[2-(4-chlorophenyl)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate (PubChem CID 2401781) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate |
|---|---|
| PubChem CID | 2401781 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(3-phenoxyphenyl)propanoate |
| SMILES | NC(=O)N[C@@H](CC(=O)OCC(=O)c1ccc(Cl)cc1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H21ClN2O5/c25-18-11-9-16(10-12-18)22(28)15-31-23(29)14-21(27-24(26)30)17-5-4-8-20(13-17)32-19-6-2-1-3-7-19/h1-13,21H,14-15H2,(H3,26,27,30)/t21-/m0/s1 |
| InChIKey | IGQPOAXTIHKSGX-NRFANRHFSA-N |
| XLogP | 4.66 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |