C21H26N4O3 — CID 9271549
(3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)-N-piperidin-1-ylpropanamide (PubChem CID 9271549) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)-N-piperidin-1-ylpropanamide.
| Compound Name | (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)-N-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 9271549 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (3R)-3-(carbamoylamino)-3-(3-phenoxyphenyl)-N-piperidin-1-ylpropanamide |
| SMILES | NC(=O)N[C@H](CC(=O)NN1CCCCC1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H26N4O3/c22-21(27)23-19(15-20(26)24-25-12-5-2-6-13-25)16-8-7-11-18(14-16)28-17-9-3-1-4-10-17/h1,3-4,7-11,14,19H,2,5-6,12-13,15H2,(H,24,26)(H3,22,23,27)/t19-/m1/s1 |
| InChIKey | BGXKZGPEPVILFJ-LJQANCHMSA-N |
| XLogP | 3.10 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |