C21H14N3O3S- — CID 9214202
4-[(Z)-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]benzoate (PubChem CID 9214202) has the molecular formula C21H14N3O3S- and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[(Z)-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]benzoate.
| Compound Name | 4-[(Z)-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 9214202 |
| Molecular Formula | C21H14N3O3S- |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-[(Z)-(6-methyl-4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)iminomethyl]benzoate |
| SMILES | Cc1sc2ncn(/N=C\c3ccc(C(=O)[O-])cc3)c(=O)c2c1-c1ccccc1 |
| InChI | InChI=1S/C21H15N3O3S/c1-13-17(15-5-3-2-4-6-15)18-19(28-13)22-12-24(20(18)25)23-11-14-7-9-16(10-8-14)21(26)27/h2-12H,1H3,(H,26,27)/p-1/b23-11- |
| InChIKey | KQAWBUMLSBSBNN-KSEXSDGBSA-M |
| XLogP | 2.68 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|