C20H28N2O2 — CID 9215377
N-[(Z)-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]-4-propan-2-yloxybenzamide (PubChem CID 9215377) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[(Z)-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]-4-propan-2-yloxybenzamide.
| Compound Name | N-[(Z)-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 9215377 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-[(Z)-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylidene]amino]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)N/N=C2/CC[C@@H]3CCCC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C20H28N2O2/c1-14(2)24-19-11-8-16(9-12-19)20(23)22-21-18-10-7-15-5-3-4-6-17(15)13-18/h8-9,11-12,14-15,17H,3-7,10,13H2,1-2H3,(H,22,23)/b21-18-/t15-,17+/m0/s1 |
| InChIKey | MNKDHLBDEAPWAC-DDPDMBSRSA-N |
| XLogP | 4.55 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|