C22H24N2O2S — CID 9218781
1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(3-ethylphenoxy)ethanone (PubChem CID 9218781) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(3-ethylphenoxy)ethanone.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(3-ethylphenoxy)ethanone |
|---|---|
| PubChem CID | 9218781 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(3-ethylphenoxy)ethanone |
| SMILES | CCc1cccc(OCC(=O)N2CCC(c3nc4ccccc4s3)CC2)c1 |
| InChI | InChI=1S/C22H24N2O2S/c1-2-16-6-5-7-18(14-16)26-15-21(25)24-12-10-17(11-13-24)22-23-19-8-3-4-9-20(19)27-22/h3-9,14,17H,2,10-13,15H2,1H3 |
| InChIKey | YJBAETPUURLOHB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |