C11H14N4S — CID 921997
[(5S)-5-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 921997) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is [(5S)-5-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [(5S)-5-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 921997 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [(5S)-5-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | C[C@H]1CCCc2sc3ncnc(NN)c3c21 |
| InChI | InChI=1S/C11H14N4S/c1-6-3-2-4-7-8(6)9-10(15-12)13-5-14-11(9)16-7/h5-6H,2-4,12H2,1H3,(H,13,14,15)/t6-/m0/s1 |
| InChIKey | MVMJMLMQRVFYHB-LURJTMIESA-N |
| XLogP | 2.42 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|