C19H30N4O3S2 — CID 9220483
1-[(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)amino]-3-pentylthiourea (PubChem CID 9220483) has the molecular formula C19H30N4O3S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-[(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)amino]-3-pentylthiourea.
| Compound Name | 1-[(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9220483 |
| Molecular Formula | C19H30N4O3S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[(2-methyl-5-piperidin-1-ylsulfonylbenzoyl)amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1C |
| InChI | InChI=1S/C19H30N4O3S2/c1-3-4-6-11-20-19(27)22-21-18(24)17-14-16(10-9-15(17)2)28(25,26)23-12-7-5-8-13-23/h9-10,14H,3-8,11-13H2,1-2H3,(H,21,24)(H2,20,22,27) |
| InChIKey | VXDUGWIGGQSAON-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|